C21H28O4Si — CID 140511957
(2R,3S)-5-[tert-butyl(diphenyl)silyl]pent-4-ene-1,2,3,5-tetrol (PubChem CID 140511957) has the molecular formula C21H28O4Si and a molecular weight of 372.54 g/mol. Its IUPAC name is (2R,3S)-5-[tert-butyl(diphenyl)silyl]pent-4-ene-1,2,3,5-tetrol.
| Compound Name | (2R,3S)-5-[tert-butyl(diphenyl)silyl]pent-4-ene-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 140511957 |
| Molecular Formula | C21H28O4Si |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (2R,3S)-5-[tert-butyl(diphenyl)silyl]pent-4-ene-1,2,3,5-tetrol |
| SMILES | CC(C)(C)[Si](C(O)=C[C@H](O)[C@H](O)CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28O4Si/c1-21(2,3)26(16-10-6-4-7-11-16,17-12-8-5-9-13-17)20(25)14-18(23)19(24)15-22/h4-14,18-19,22-25H,15H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | UTOUFEGWNXMWMB-RBUKOAKNSA-N |
| XLogP | 1.74 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|