C10H13NO3 — CID 98079118
(2R,3S)-4-phenyliminobutane-1,2,3-triol (PubChem CID 98079118) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (2R,3S)-4-phenyliminobutane-1,2,3-triol.
| Compound Name | (2R,3S)-4-phenyliminobutane-1,2,3-triol |
|---|---|
| PubChem CID | 98079118 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (2R,3S)-4-phenyliminobutane-1,2,3-triol |
| SMILES | OC[C@@H](O)[C@@H](O)/C=N/c1ccccc1 |
| InChI | InChI=1S/C10H13NO3/c12-7-10(14)9(13)6-11-8-4-2-1-3-5-8/h1-6,9-10,12-14H,7H2/b11-6+/t9-,10+/m0/s1 |
| InChIKey | CBNAFOPDRKRMGR-GAOAYCLHSA-N |
| XLogP | 0.10 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|