C17H20N2O3 — CID 98511351
(2R,3R,4E)-4-[benzyl(phenyl)hydrazinylidene]butane-1,2,3-triol (PubChem CID 98511351) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is (2R,3R,4E)-4-[benzyl(phenyl)hydrazinylidene]butane-1,2,3-triol.
| Compound Name | (2R,3R,4E)-4-[benzyl(phenyl)hydrazinylidene]butane-1,2,3-triol |
|---|---|
| PubChem CID | 98511351 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (2R,3R,4E)-4-[benzyl(phenyl)hydrazinylidene]butane-1,2,3-triol |
| SMILES | OC[C@@H](O)[C@H](O)/C=N/N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O3/c20-13-17(22)16(21)11-18-19(15-9-5-2-6-10-15)12-14-7-3-1-4-8-14/h1-11,16-17,20-22H,12-13H2/b18-11+/t16-,17-/m1/s1 |
| InChIKey | PXFODPZGCYQHHM-RHUDWFJBSA-N |
| XLogP | 1.39 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|