C18H22N2O5 — CID 67783698
(2R,3R,4R,5S)-6-(diphenylhydrazinylidene)hexane-1,2,3,4,5-pentol (PubChem CID 67783698) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-(diphenylhydrazinylidene)hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-(diphenylhydrazinylidene)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 67783698 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (2R,3R,4R,5S)-6-(diphenylhydrazinylidene)hexane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O5/c21-12-16(23)18(25)17(24)15(22)11-19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-11,15-18,21-25H,12H2/t15-,16+,17+,18+/m0/s1 |
| InChIKey | AAGYENAIRJWWBZ-BSDSXHPESA-N |
| XLogP | 0.25 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|