C20H22N4O5 — CID 10572933
(2R,3S,4R,5S,6E)-6-[(2-phenylquinazolin-4-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol (PubChem CID 10572933) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is (2R,3S,4R,5S,6E)-6-[(2-phenylquinazolin-4-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3S,4R,5S,6E)-6-[(2-phenylquinazolin-4-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 10572933 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (2R,3S,4R,5S,6E)-6-[(2-phenylquinazolin-4-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)/C=N/Nc1nc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C20H22N4O5/c25-11-16(27)18(29)17(28)15(26)10-21-24-20-13-8-4-5-9-14(13)22-19(23-20)12-6-2-1-3-7-12/h1-10,15-18,25-29H,11H2,(H,22,23,24)/b21-10+/t15-,16+,17+,18-/m0/s1 |
| InChIKey | RHXIRVRJLCISOY-USJVFQSZSA-N |
| XLogP | 0.13 |
| TPSA | 151.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|