C19H20N4O4 — CID 139229642
(2R,3R,5E)-5-[(3-phenylquinoxalin-2-yl)hydrazinylidene]pentane-1,2,3,4-tetrol (PubChem CID 139229642) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is (2R,3R,5E)-5-[(3-phenylquinoxalin-2-yl)hydrazinylidene]pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3R,5E)-5-[(3-phenylquinoxalin-2-yl)hydrazinylidene]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 139229642 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (2R,3R,5E)-5-[(3-phenylquinoxalin-2-yl)hydrazinylidene]pentane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@H](O)C(O)/C=N/Nc1nc2ccccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C19H20N4O4/c24-11-16(26)18(27)15(25)10-20-23-19-17(12-6-2-1-3-7-12)21-13-8-4-5-9-14(13)22-19/h1-10,15-16,18,24-27H,11H2,(H,22,23)/b20-10+/t15?,16-,18-/m1/s1 |
| InChIKey | XTHMAXOETJHZRF-KSTBAHLCSA-N |
| XLogP | 0.77 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|