C28H26N4O5 — CID 72694814
6-naphthalen-2-yl-2-[(2E)-2-[(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]hydrazinyl]-4-phenylpyridine-3-carbonitrile (PubChem CID 72694814) has the molecular formula C28H26N4O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is 6-naphthalen-2-yl-2-[(2E)-2-[(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]hydrazinyl]-4-phenylpyridine-3-carbonitrile.
| Compound Name | 6-naphthalen-2-yl-2-[(2E)-2-[(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]hydrazinyl]-4-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 72694814 |
| Molecular Formula | C28H26N4O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 6-naphthalen-2-yl-2-[(2E)-2-[(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]hydrazinyl]-4-phenylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2ccc3ccccc3c2)nc1N/N=C/[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C28H26N4O5/c29-14-22-21(18-7-2-1-3-8-18)13-23(20-11-10-17-6-4-5-9-19(17)12-20)31-28(22)32-30-15-24(34)26(36)27(37)25(35)16-33/h1-13,15,24-27,33-37H,16H2,(H,31,32)/b30-15+/t24-,25-,26+,27+/m1/s1 |
| InChIKey | UQLBDVSHBBYVOP-LPCTTWCHSA-N |
| XLogP | 2.27 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|