C24H27ClN4O6 — CID 42630942
(2R,3R,4R,5S,6E)-6-[[6-(4-chlorophenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]hexane-1,2,3,4,5-pentol (PubChem CID 42630942) has the molecular formula C24H27ClN4O6 and a molecular weight of 502.96 g/mol. Its IUPAC name is (2R,3R,4R,5S,6E)-6-[[6-(4-chlorophenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S,6E)-6-[[6-(4-chlorophenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 42630942 |
| Molecular Formula | C24H27ClN4O6 |
| Molecular Weight | 502.96 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | (2R,3R,4R,5S,6E)-6-[[6-(4-chlorophenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]hexane-1,2,3,4,5-pentol |
| SMILES | COc1ccccc1Cc1cc(-c2ccc(Cl)cc2)nnc1N/N=C/[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C24H27ClN4O6/c1-35-21-5-3-2-4-15(21)10-16-11-18(14-6-8-17(25)9-7-14)27-29-24(16)28-26-12-19(31)22(33)23(34)20(32)13-30/h2-9,11-12,19-20,22-23,30-34H,10,13H2,1H3,(H,28,29)/b26-12+/t19-,20+,22+,23+/m0/s1 |
| InChIKey | QCEBXJLVNJDARG-GAXLOFATSA-N |
| XLogP | 1.23 |
| TPSA | 160.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.96 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|