C27H26N4O3 — CID 135879390
2-methoxy-4-[(E)-[[4-[(2-methoxyphenyl)methyl]-6-(4-methylphenyl)pyridazin-3-yl]hydrazinylidene]methyl]phenol (PubChem CID 135879390) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-methoxy-4-[(E)-[[4-[(2-methoxyphenyl)methyl]-6-(4-methylphenyl)pyridazin-3-yl]hydrazinylidene]methyl]phenol.
| Compound Name | 2-methoxy-4-[(E)-[[4-[(2-methoxyphenyl)methyl]-6-(4-methylphenyl)pyridazin-3-yl]hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135879390 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-methoxy-4-[(E)-[[4-[(2-methoxyphenyl)methyl]-6-(4-methylphenyl)pyridazin-3-yl]hydrazinylidene]methyl]phenol |
| SMILES | COc1cc(/C=N/Nc2nnc(-c3ccc(C)cc3)cc2Cc2ccccc2OC)ccc1O |
| InChI | InChI=1S/C27H26N4O3/c1-18-8-11-20(12-9-18)23-16-22(15-21-6-4-5-7-25(21)33-2)27(31-29-23)30-28-17-19-10-13-24(32)26(14-19)34-3/h4-14,16-17,32H,15H2,1-3H3,(H,30,31)/b28-17+ |
| InChIKey | FBFKGHRKRYXNHB-OGLMXYFKSA-N |
| XLogP | 5.21 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|