C36H34N4O6 — CID 42632627
3-methoxy-4-[2-[2-methoxy-4-[(E)-[[4-[(2-methoxyphenyl)methyl]-6-phenylpyridazin-3-yl]hydrazinylidene]methyl]phenoxy]ethoxy]benzaldehyde (PubChem CID 42632627) has the molecular formula C36H34N4O6 and a molecular weight of 618.69 g/mol. Its IUPAC name is 3-methoxy-4-[2-[2-methoxy-4-[(E)-[[4-[(2-methoxyphenyl)methyl]-6-phenylpyridazin-3-yl]hydrazinylidene]methyl]phenoxy]ethoxy]benzaldehyde.
| Compound Name | 3-methoxy-4-[2-[2-methoxy-4-[(E)-[[4-[(2-methoxyphenyl)methyl]-6-phenylpyridazin-3-yl]hydrazinylidene]methyl]phenoxy]ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 42632627 |
| Molecular Formula | C36H34N4O6 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | 3-methoxy-4-[2-[2-methoxy-4-[(E)-[[4-[(2-methoxyphenyl)methyl]-6-phenylpyridazin-3-yl]hydrazinylidene]methyl]phenoxy]ethoxy]benzaldehyde |
| SMILES | COc1ccccc1Cc1cc(-c2ccccc2)nnc1N/N=C/c1ccc(OCCOc2ccc(C=O)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C36H34N4O6/c1-42-31-12-8-7-11-28(31)21-29-22-30(27-9-5-4-6-10-27)38-40-36(29)39-37-23-25-13-15-32(34(19-25)43-2)45-17-18-46-33-16-14-26(24-41)20-35(33)44-3/h4-16,19-20,22-24H,17-18,21H2,1-3H3,(H,39,40)/b37-23+ |
| InChIKey | CWMMDFPNCAOFHY-GUBAARJWSA-N |
| XLogP | 6.48 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|