C35H40N4O12 — CID 45272912
[(6E)-2,3,4,5-tetraacetyloxy-6-[[6-(4-methoxyphenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]hexyl] acetate (PubChem CID 45272912) has the molecular formula C35H40N4O12 and a molecular weight of 708.72 g/mol. Its IUPAC name is [(6E)-2,3,4,5-tetraacetyloxy-6-[[6-(4-methoxyphenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]hexyl] acetate.
| Compound Name | [(6E)-2,3,4,5-tetraacetyloxy-6-[[6-(4-methoxyphenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]hexyl] acetate |
|---|---|
| PubChem CID | 45272912 |
| Molecular Formula | C35H40N4O12 |
| Molecular Weight | 708.72 g/mol |
| Exact Mass | 708.26 |
| IUPAC Name | [(6E)-2,3,4,5-tetraacetyloxy-6-[[6-(4-methoxyphenyl)-4-[(2-methoxyphenyl)methyl]pyridazin-3-yl]hydrazinylidene]hexyl] acetate |
| SMILES | COc1ccc(-c2cc(Cc3ccccc3OC)c(N/N=C/C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O)nn2)cc1 |
| InChI | InChI=1S/C35H40N4O12/c1-20(40)47-19-32(49-22(3)42)34(51-24(5)44)33(50-23(4)43)31(48-21(2)41)18-36-38-35-27(16-26-10-8-9-11-30(26)46-7)17-29(37-39-35)25-12-14-28(45-6)15-13-25/h8-15,17-18,31-34H,16,19H2,1-7H3,(H,38,39)/b36-18+ |
| InChIKey | IPQUMCJNKCKAEX-IZYHBKOJSA-N |
| XLogP | 3.44 |
| TPSA | 200.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.72 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|