C22H22N4O2 — CID 42631799
(3Z)-3-[[4-[(2-methoxyphenyl)methyl]-6-phenylpyridazin-3-yl]hydrazinylidene]butan-2-one (PubChem CID 42631799) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is (3Z)-3-[[4-[(2-methoxyphenyl)methyl]-6-phenylpyridazin-3-yl]hydrazinylidene]butan-2-one.
| Compound Name | (3Z)-3-[[4-[(2-methoxyphenyl)methyl]-6-phenylpyridazin-3-yl]hydrazinylidene]butan-2-one |
|---|---|
| PubChem CID | 42631799 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (3Z)-3-[[4-[(2-methoxyphenyl)methyl]-6-phenylpyridazin-3-yl]hydrazinylidene]butan-2-one |
| SMILES | COc1ccccc1Cc1cc(-c2ccccc2)nnc1N/N=C(/C)C(C)=O |
| InChI | InChI=1S/C22H22N4O2/c1-15(16(2)27)23-25-22-19(13-18-11-7-8-12-21(18)28-3)14-20(24-26-22)17-9-5-4-6-10-17/h4-12,14H,13H2,1-3H3,(H,25,26)/b23-15- |
| InChIKey | YCVZSQNWIOOVAF-HAHDFKILSA-N |
| XLogP | 4.12 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|