C15H18N4O5 — CID 136843378
(4Z)-4-benzylidene-2-[(2Z)-2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentylidene]hydrazinyl]-1H-imidazol-5-one (PubChem CID 136843378) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is (4Z)-4-benzylidene-2-[(2Z)-2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentylidene]hydrazinyl]-1H-imidazol-5-one.
| Compound Name | (4Z)-4-benzylidene-2-[(2Z)-2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentylidene]hydrazinyl]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136843378 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (4Z)-4-benzylidene-2-[(2Z)-2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentylidene]hydrazinyl]-1H-imidazol-5-one |
| SMILES | O=C1NC(N/N=C\[C@H](O)[C@H](O)[C@H](O)CO)=N/C1=C\c1ccccc1 |
| InChI | InChI=1S/C15H18N4O5/c20-8-12(22)13(23)11(21)7-16-19-15-17-10(14(24)18-15)6-9-4-2-1-3-5-9/h1-7,11-13,20-23H,8H2,(H2,17,18,19,24)/b10-6-,16-7-/t11-,12+,13-/m0/s1 |
| InChIKey | IZFWHMMSFXMNEO-DJYZBBSYSA-N |
| XLogP | -1.84 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|