C13H10N4OS2 — CID 135519071
(4Z)-4-(thiophen-2-ylmethylidene)-2-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]-1H-imidazol-5-one (PubChem CID 135519071) has the molecular formula C13H10N4OS2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (4Z)-4-(thiophen-2-ylmethylidene)-2-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]-1H-imidazol-5-one.
| Compound Name | (4Z)-4-(thiophen-2-ylmethylidene)-2-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 135519071 |
| Molecular Formula | C13H10N4OS2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | (4Z)-4-(thiophen-2-ylmethylidene)-2-[(2E)-2-(thiophen-2-ylmethylidene)hydrazinyl]-1H-imidazol-5-one |
| SMILES | O=C1NC(N/N=C/c2cccs2)=N/C1=C\c1cccs1 |
| InChI | InChI=1S/C13H10N4OS2/c18-12-11(7-9-3-1-5-19-9)15-13(16-12)17-14-8-10-4-2-6-20-10/h1-8H,(H2,15,16,17,18)/b11-7-,14-8+ |
| InChIKey | DMJOSBZZJQXAJZ-WIFBXHMDSA-N |
| XLogP | 2.26 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|