C14H8ClIN2OS — CID 135539324
2-(2-chloro-5-iodophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one (PubChem CID 135539324) has the molecular formula C14H8ClIN2OS and a molecular weight of 414.66 g/mol. Its IUPAC name is 2-(2-chloro-5-iodophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one.
| Compound Name | 2-(2-chloro-5-iodophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 135539324 |
| Molecular Formula | C14H8ClIN2OS |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 413.91 |
| IUPAC Name | 2-(2-chloro-5-iodophenyl)-4-(thiophen-2-ylmethylidene)-1H-imidazol-5-one |
| SMILES | O=C1NC(c2cc(I)ccc2Cl)=NC1=Cc1cccs1 |
| InChI | InChI=1S/C14H8ClIN2OS/c15-11-4-3-8(16)6-10(11)13-17-12(14(19)18-13)7-9-2-1-5-20-9/h1-7H,(H,17,18,19) |
| InChIKey | MGMJPQBSNQURNH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|