C18H14N2O4S2 — CID 139087233
(4Z)-2-methyl-4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 139087233) has the molecular formula C18H14N2O4S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is (4Z)-2-methyl-4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-methyl-4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 139087233 |
| Molecular Formula | C18H14N2O4S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | (4Z)-2-methyl-4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | CC1=N/C(=C\c2cccs2)C(=O)O1.CC1=N/C(=C\c2cccs2)C(=O)O1 |
| InChI | InChI=1S/2C9H7NO2S/c2*1-6-10-8(9(11)12-6)5-7-3-2-4-13-7/h2*2-5H,1H3/b2*8-5- |
| InChIKey | ORWQWHLUXGXIEL-VKNAHIEFSA-N |
| XLogP | 4.13 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|