C11H8FNO2 — CID 2306688
(4Z)-4-[(4-fluorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one (PubChem CID 2306688) has the molecular formula C11H8FNO2 and a molecular weight of 205.19 g/mol. Its IUPAC name is (4Z)-4-[(4-fluorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-fluorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2306688 |
| Molecular Formula | C11H8FNO2 |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | (4Z)-4-[(4-fluorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one |
| SMILES | CC1=N/C(=C\c2ccc(F)cc2)C(=O)O1 |
| InChI | InChI=1S/C11H8FNO2/c1-7-13-10(11(14)15-7)6-8-2-4-9(12)5-3-8/h2-6H,1H3/b10-6- |
| InChIKey | CJDRPIOMZCOCEB-POHAHGRESA-N |
| XLogP | 2.14 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|