C13H11NO3 — CID 142723384
(4Z)-4-[(4-acetylphenyl)methylidene]-2-methyl-1,3-oxazol-5-one (PubChem CID 142723384) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is (4Z)-4-[(4-acetylphenyl)methylidene]-2-methyl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-acetylphenyl)methylidene]-2-methyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 142723384 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (4Z)-4-[(4-acetylphenyl)methylidene]-2-methyl-1,3-oxazol-5-one |
| SMILES | CC(=O)c1ccc(/C=C2\N=C(C)OC2=O)cc1 |
| InChI | InChI=1S/C13H11NO3/c1-8(15)11-5-3-10(4-6-11)7-12-13(16)17-9(2)14-12/h3-7H,1-2H3/b12-7- |
| InChIKey | GNEXFYPCUFLOBD-GHXNOFRVSA-N |
| XLogP | 2.21 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|