C11H7F2NO2 — CID 96893973
(4E)-4-[(2,5-difluorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one (PubChem CID 96893973) has the molecular formula C11H7F2NO2 and a molecular weight of 223.18 g/mol. Its IUPAC name is (4E)-4-[(2,5-difluorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(2,5-difluorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 96893973 |
| Molecular Formula | C11H7F2NO2 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | (4E)-4-[(2,5-difluorophenyl)methylidene]-2-methyl-1,3-oxazol-5-one |
| SMILES | CC1=N/C(=C/c2cc(F)ccc2F)C(=O)O1 |
| InChI | InChI=1S/C11H7F2NO2/c1-6-14-10(11(15)16-6)5-7-4-8(12)2-3-9(7)13/h2-5H,1H3/b10-5+ |
| InChIKey | WXPBRLXDFVOOBC-BJMVGYQFSA-N |
| XLogP | 2.28 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|