C16H22N4O6 — CID 11728249
3-ethyl-2-[(2E)-2-[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]hydrazinyl]quinazolin-4-one (PubChem CID 11728249) has the molecular formula C16H22N4O6 and a molecular weight of 366.37 g/mol. Its IUPAC name is 3-ethyl-2-[(2E)-2-[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]hydrazinyl]quinazolin-4-one.
| Compound Name | 3-ethyl-2-[(2E)-2-[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]hydrazinyl]quinazolin-4-one |
|---|---|
| PubChem CID | 11728249 |
| Molecular Formula | C16H22N4O6 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 3-ethyl-2-[(2E)-2-[(2S,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]hydrazinyl]quinazolin-4-one |
| SMILES | CCn1c(N/N=C/[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO)nc2ccccc2c1=O |
| InChI | InChI=1S/C16H22N4O6/c1-2-20-15(26)9-5-3-4-6-10(9)18-16(20)19-17-7-11(22)13(24)14(25)12(23)8-21/h3-7,11-14,21-25H,2,8H2,1H3,(H,18,19)/b17-7+/t11-,12+,13+,14-/m0/s1 |
| InChIKey | RZHZDDZAQAYUCL-YTNLRJEUSA-N |
| XLogP | -1.75 |
| TPSA | 160.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|