C20H24N4O — CID 8983496
2-[2-(2-adamantylidene)hydrazinyl]-3-ethylquinazolin-4-one (PubChem CID 8983496) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[2-(2-adamantylidene)hydrazinyl]-3-ethylquinazolin-4-one.
| Compound Name | 2-[2-(2-adamantylidene)hydrazinyl]-3-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 8983496 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-[2-(2-adamantylidene)hydrazinyl]-3-ethylquinazolin-4-one |
| SMILES | CCn1c(NN=C2C3CC4CC(C3)CC2C4)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H24N4O/c1-2-24-19(25)16-5-3-4-6-17(16)21-20(24)23-22-18-14-8-12-7-13(10-14)11-15(18)9-12/h3-6,12-15H,2,7-11H2,1H3,(H,21,23)/b22-18- |
| InChIKey | HNBZNBWIPNRSJG-PYCFMQQDSA-N |
| XLogP | 3.64 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|