C20H20N4O — CID 8983845
2-[(2Z)-2-(3,4-dihydro-1H-naphthalen-2-ylidene)hydrazinyl]-3-ethylquinazolin-4-one (PubChem CID 8983845) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-[(2Z)-2-(3,4-dihydro-1H-naphthalen-2-ylidene)hydrazinyl]-3-ethylquinazolin-4-one.
| Compound Name | 2-[(2Z)-2-(3,4-dihydro-1H-naphthalen-2-ylidene)hydrazinyl]-3-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 8983845 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-[(2Z)-2-(3,4-dihydro-1H-naphthalen-2-ylidene)hydrazinyl]-3-ethylquinazolin-4-one |
| SMILES | CCn1c(N/N=C2/CCc3ccccc3C2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H20N4O/c1-2-24-19(25)17-9-5-6-10-18(17)21-20(24)23-22-16-12-11-14-7-3-4-8-15(14)13-16/h3-10H,2,11-13H2,1H3,(H,21,23)/b22-16- |
| InChIKey | QGTXDOUKWIVACV-JWGURIENSA-N |
| XLogP | 3.37 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|