C24H28N4O2 — CID 9299535
3-(3-methoxypropyl)-2-[2-(4-phenylcyclohexylidene)hydrazinyl]quinazolin-4-one (PubChem CID 9299535) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-2-[2-(4-phenylcyclohexylidene)hydrazinyl]quinazolin-4-one.
| Compound Name | 3-(3-methoxypropyl)-2-[2-(4-phenylcyclohexylidene)hydrazinyl]quinazolin-4-one |
|---|---|
| PubChem CID | 9299535 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 3-(3-methoxypropyl)-2-[2-(4-phenylcyclohexylidene)hydrazinyl]quinazolin-4-one |
| SMILES | COCCCn1c(NN=C2CCC(c3ccccc3)CC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H28N4O2/c1-30-17-7-16-28-23(29)21-10-5-6-11-22(21)25-24(28)27-26-20-14-12-19(13-15-20)18-8-3-2-4-9-18/h2-6,8-11,19H,7,12-17H2,1H3,(H,25,27)/b26-20- |
| InChIKey | HIKMVGUXONPPRC-QOMWVZHYSA-N |
| XLogP | 4.56 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|