C21H22F2N4O2 — CID 8984479
2-[(2Z)-2-[1-(3,4-difluorophenyl)ethylidene]hydrazinyl]-3-(3-ethoxypropyl)quinazolin-4-one (PubChem CID 8984479) has the molecular formula C21H22F2N4O2 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-[(2Z)-2-[1-(3,4-difluorophenyl)ethylidene]hydrazinyl]-3-(3-ethoxypropyl)quinazolin-4-one.
| Compound Name | 2-[(2Z)-2-[1-(3,4-difluorophenyl)ethylidene]hydrazinyl]-3-(3-ethoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 8984479 |
| Molecular Formula | C21H22F2N4O2 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[(2Z)-2-[1-(3,4-difluorophenyl)ethylidene]hydrazinyl]-3-(3-ethoxypropyl)quinazolin-4-one |
| SMILES | CCOCCCn1c(N/N=C(/C)c2ccc(F)c(F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H22F2N4O2/c1-3-29-12-6-11-27-20(28)16-7-4-5-8-19(16)24-21(27)26-25-14(2)15-9-10-17(22)18(23)13-15/h4-5,7-10,13H,3,6,11-12H2,1-2H3,(H,24,26)/b25-14- |
| InChIKey | RGAIJMMVXRWYHU-QFEZKATASA-N |
| XLogP | 3.94 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|