C25H21N5O — CID 135729400
3-ethyl-2-[(2E)-2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]quinazolin-4-one (PubChem CID 135729400) has the molecular formula C25H21N5O and a molecular weight of 407.48 g/mol. Its IUPAC name is 3-ethyl-2-[(2E)-2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]quinazolin-4-one.
| Compound Name | 3-ethyl-2-[(2E)-2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]quinazolin-4-one |
|---|---|
| PubChem CID | 135729400 |
| Molecular Formula | C25H21N5O |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 3-ethyl-2-[(2E)-2-[(2-phenyl-1H-indol-3-yl)methylidene]hydrazinyl]quinazolin-4-one |
| SMILES | CCn1c(N/N=C/c2c(-c3ccccc3)[nH]c3ccccc23)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H21N5O/c1-2-30-24(31)19-13-7-9-15-22(19)28-25(30)29-26-16-20-18-12-6-8-14-21(18)27-23(20)17-10-4-3-5-11-17/h3-16,27H,2H2,1H3,(H,28,29)/b26-16+ |
| InChIKey | AQUIORCFWYCWQY-WGOQTCKBSA-N |
| XLogP | 5.01 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|