C17H22N6O5 — CID 10596541
(2R,3R,4R,5S,6E)-6-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol (PubChem CID 10596541) has the molecular formula C17H22N6O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is (2R,3R,4R,5S,6E)-6-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S,6E)-6-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 10596541 |
| Molecular Formula | C17H22N6O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (2R,3R,4R,5S,6E)-6-[(5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]hexane-1,2,3,4,5-pentol |
| SMILES | CCn1c2ccccc2c2nnc(N/N=C/[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)nc21 |
| InChI | InChI=1S/C17H22N6O5/c1-2-23-10-6-4-3-5-9(10)13-16(23)19-17(22-20-13)21-18-7-11(25)14(27)15(28)12(26)8-24/h3-7,11-12,14-15,24-28H,2,8H2,1H3,(H,19,21,22)/b18-7+/t11-,12+,14+,15+/m0/s1 |
| InChIKey | JNJLOXZQVAQBEW-VBVZMQTBSA-N |
| XLogP | -1.17 |
| TPSA | 169.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|