C21H22N6O — CID 6808001
N-[1-(4-ethoxyphenyl)ethylideneamino]-5-ethyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 6808001) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is N-[1-(4-ethoxyphenyl)ethylideneamino]-5-ethyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[1-(4-ethoxyphenyl)ethylideneamino]-5-ethyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 6808001 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | N-[1-(4-ethoxyphenyl)ethylideneamino]-5-ethyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCOc1ccc(C(C)=NNc2nnc3c4ccccc4n(CC)c3n2)cc1 |
| InChI | InChI=1S/C21H22N6O/c1-4-27-18-9-7-6-8-17(18)19-20(27)22-21(26-24-19)25-23-14(3)15-10-12-16(13-11-15)28-5-2/h6-13H,4-5H2,1-3H3,(H,22,25,26) |
| InChIKey | IGJBWMQDCRGUMB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|