C19H18N6O — CID 7398475
N-[(E)-1-(4-ethoxyphenyl)ethylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine (PubChem CID 7398475) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[(E)-1-(4-ethoxyphenyl)ethylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine.
| Compound Name | N-[(E)-1-(4-ethoxyphenyl)ethylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
|---|---|
| PubChem CID | 7398475 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[(E)-1-(4-ethoxyphenyl)ethylideneamino]-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
| SMILES | CCOc1ccc(/C(C)=N/Nc2nn3cnnc3c3ccccc23)cc1 |
| InChI | InChI=1S/C19H18N6O/c1-3-26-15-10-8-14(9-11-15)13(2)21-22-18-16-6-4-5-7-17(16)19-23-20-12-25(19)24-18/h4-12H,3H2,1-2H3,(H,22,24)/b21-13+ |
| InChIKey | QTRDIBOKXFPMPU-FYJGNVAPSA-N |
| XLogP | 3.51 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|