C21H18N2 — CID 54551513
N,N',2-triphenylpropane-1,3-diimine (PubChem CID 54551513) has the molecular formula C21H18N2 and a molecular weight of 298.39 g/mol. Its IUPAC name is N,N',2-triphenylpropane-1,3-diimine.
| Compound Name | N,N',2-triphenylpropane-1,3-diimine |
|---|---|
| PubChem CID | 54551513 |
| Molecular Formula | C21H18N2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N,N',2-triphenylpropane-1,3-diimine |
| SMILES | C(=N/c1ccccc1)\C(/C=N/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18N2/c1-4-10-18(11-5-1)19(16-22-20-12-6-2-7-13-20)17-23-21-14-8-3-9-15-21/h1-17,19H/b22-16+,23-17+ |
| InChIKey | ZKFMDUUKIUTYAR-LKNRODPVSA-N |
| XLogP | 5.58 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|