C15H15BrN2Pd — CID 22968105
bromopalladium(1+);carbanide;N,N'-diphenylethane-1,2-diimine (PubChem CID 22968105) has the molecular formula C15H15BrN2Pd and a molecular weight of 409.62 g/mol. Its IUPAC name is bromopalladium(1+);carbanide;N,N'-diphenylethane-1,2-diimine.
| Compound Name | bromopalladium(1+);carbanide;N,N'-diphenylethane-1,2-diimine |
|---|---|
| PubChem CID | 22968105 |
| Molecular Formula | C15H15BrN2Pd |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | bromopalladium(1+);carbanide;N,N'-diphenylethane-1,2-diimine |
| SMILES | Br[Pd+].C(/C=N/c1ccccc1)=N\c1ccccc1.[CH3-] |
| InChI | InChI=1S/C14H12N2.CH3.BrH.Pd/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14;;;/h1-12H;1H3;1H;/q;-1;;+2/p-1/b15-11+,16-12+;;; |
| InChIKey | WIOGFRVKTNIYAA-KAFKVMRASA-M |
| XLogP | 5.08 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|