C50H64Cl2Si4 — CID 102420798
[(3E,9E)-4,9-bis[tert-butyl(diphenyl)silyl]-3,10-dichloro-12-trimethylsilyldodeca-3,9-dien-5,7-diynyl]-trimethylsilane (PubChem CID 102420798) has the molecular formula C50H64Cl2Si4 and a molecular weight of 848.31 g/mol. Its IUPAC name is [(3E,9E)-4,9-bis[tert-butyl(diphenyl)silyl]-3,10-dichloro-12-trimethylsilyldodeca-3,9-dien-5,7-diynyl]-trimethylsilane.
| Compound Name | [(3E,9E)-4,9-bis[tert-butyl(diphenyl)silyl]-3,10-dichloro-12-trimethylsilyldodeca-3,9-dien-5,7-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 102420798 |
| Molecular Formula | C50H64Cl2Si4 |
| Molecular Weight | 848.31 g/mol |
| Exact Mass | 846.35 |
| IUPAC Name | [(3E,9E)-4,9-bis[tert-butyl(diphenyl)silyl]-3,10-dichloro-12-trimethylsilyldodeca-3,9-dien-5,7-diynyl]-trimethylsilane |
| SMILES | CC(C)(C)[Si](/C(C#CC#C/C(=C(\Cl)CC[Si](C)(C)C)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)=C(/Cl)CC[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H64Cl2Si4/c1-49(2,3)55(41-27-17-13-18-28-41,42-29-19-14-20-30-42)47(45(51)37-39-53(7,8)9)35-25-26-36-48(46(52)38-40-54(10,11)12)56(50(4,5)6,43-31-21-15-22-32-43)44-33-23-16-24-34-44/h13-24,27-34H,37-40H2,1-12H3/b47-45+,48-46+ |
| InChIKey | PFJIHILFHSWGQV-MLGMXDONSA-N |
| XLogP | 12.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.31 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|