C29H34O3Si — CID 102433781
[(1R,2R)-3-[tert-butyl(diphenyl)silyl]-2-methyl-3-oxo-1-phenylpropyl] propanoate (PubChem CID 102433781) has the molecular formula C29H34O3Si and a molecular weight of 458.67 g/mol. Its IUPAC name is [(1R,2R)-3-[tert-butyl(diphenyl)silyl]-2-methyl-3-oxo-1-phenylpropyl] propanoate.
| Compound Name | [(1R,2R)-3-[tert-butyl(diphenyl)silyl]-2-methyl-3-oxo-1-phenylpropyl] propanoate |
|---|---|
| PubChem CID | 102433781 |
| Molecular Formula | C29H34O3Si |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | [(1R,2R)-3-[tert-butyl(diphenyl)silyl]-2-methyl-3-oxo-1-phenylpropyl] propanoate |
| SMILES | CCC(=O)O[C@@H](c1ccccc1)[C@@H](C)C(=O)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H34O3Si/c1-6-26(30)32-27(23-16-10-7-11-17-23)22(2)28(31)33(29(3,4)5,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-22,27H,6H2,1-5H3/t22-,27-/m1/s1 |
| InChIKey | UQHLSVOCEMQIKL-AJTFRIOCSA-N |
| XLogP | 5.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|