C25H32O4Si — CID 10928017
[(2R,3R)-5-[tert-butyl(diphenyl)silyl]-3-hydroxy-3-methyl-4-oxohex-5-en-2-yl] acetate (PubChem CID 10928017) has the molecular formula C25H32O4Si and a molecular weight of 424.61 g/mol. Its IUPAC name is [(2R,3R)-5-[tert-butyl(diphenyl)silyl]-3-hydroxy-3-methyl-4-oxohex-5-en-2-yl] acetate.
| Compound Name | [(2R,3R)-5-[tert-butyl(diphenyl)silyl]-3-hydroxy-3-methyl-4-oxohex-5-en-2-yl] acetate |
|---|---|
| PubChem CID | 10928017 |
| Molecular Formula | C25H32O4Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(2R,3R)-5-[tert-butyl(diphenyl)silyl]-3-hydroxy-3-methyl-4-oxohex-5-en-2-yl] acetate |
| SMILES | C=C(C(=O)[C@](C)(O)[C@@H](C)OC(C)=O)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H32O4Si/c1-18(23(27)25(7,28)19(2)29-20(3)26)30(24(4,5)6,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17,19,28H,1H2,2-7H3/t19-,25-/m1/s1 |
| InChIKey | KTVAMHYZPOSPDP-KBMIEXCESA-N |
| XLogP | 3.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|