C32H48O4Si2 — CID 174976118
[tert-butyl(diphenyl)silyl] 2-methylprop-2-enoate;tri(propan-2-yl)silyl prop-2-enoate (PubChem CID 174976118) has the molecular formula C32H48O4Si2 and a molecular weight of 552.90 g/mol. Its IUPAC name is [tert-butyl(diphenyl)silyl] 2-methylprop-2-enoate;tri(propan-2-yl)silyl prop-2-enoate.
| Compound Name | [tert-butyl(diphenyl)silyl] 2-methylprop-2-enoate;tri(propan-2-yl)silyl prop-2-enoate |
|---|---|
| PubChem CID | 174976118 |
| Molecular Formula | C32H48O4Si2 |
| Molecular Weight | 552.90 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | [tert-butyl(diphenyl)silyl] 2-methylprop-2-enoate;tri(propan-2-yl)silyl prop-2-enoate |
| SMILES | C=C(C)C(=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.C=CC(=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H24O2Si.C12H24O2Si/c1-16(2)19(21)22-23(20(3,4)5,17-12-8-6-9-13-17)18-14-10-7-11-15-18;1-8-12(13)14-15(9(2)3,10(4)5)11(6)7/h6-15H,1H2,2-5H3;8-11H,1H2,2-7H3 |
| InChIKey | YDKJMTLAZGGOLX-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.90 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|