C17H24O — CID 101438010
(2S)-3-methyl-5-phenyldeca-3,4-dien-2-ol (PubChem CID 101438010) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (2S)-3-methyl-5-phenyldeca-3,4-dien-2-ol.
| Compound Name | (2S)-3-methyl-5-phenyldeca-3,4-dien-2-ol |
|---|---|
| PubChem CID | 101438010 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (2S)-3-methyl-5-phenyldeca-3,4-dien-2-ol |
| SMILES | CCCCCC(=C=C(C)[C@H](C)O)c1ccccc1 |
| InChI | InChI=1S/C17H24O/c1-4-5-7-12-17(13-14(2)15(3)18)16-10-8-6-9-11-16/h6,8-11,15,18H,4-5,7,12H2,1-3H3/t13?,15-/m0/s1 |
| InChIKey | SQOBVGJROWJWEN-WUJWULDRSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|