C20H28O2 — CID 46210116
(Z)-7-methyl-3-pentyl-4-phenyloct-3-en-5-yne-2,7-diol (PubChem CID 46210116) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (Z)-7-methyl-3-pentyl-4-phenyloct-3-en-5-yne-2,7-diol.
| Compound Name | (Z)-7-methyl-3-pentyl-4-phenyloct-3-en-5-yne-2,7-diol |
|---|---|
| PubChem CID | 46210116 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (Z)-7-methyl-3-pentyl-4-phenyloct-3-en-5-yne-2,7-diol |
| SMILES | CCCCC/C(=C(/C#CC(C)(C)O)c1ccccc1)C(C)O |
| InChI | InChI=1S/C20H28O2/c1-5-6-8-13-18(16(2)21)19(14-15-20(3,4)22)17-11-9-7-10-12-17/h7,9-12,16,21-22H,5-6,8,13H2,1-4H3/b19-18+ |
| InChIKey | WLALJEYVSQMPRP-VHEBQXMUSA-N |
| XLogP | 4.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|