C18H23N3O — CID 10685430
1-(1-ethoxy-3-phenylocta-1,2-dienyl)-1,2,4-triazole (PubChem CID 10685430) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-(1-ethoxy-3-phenylocta-1,2-dienyl)-1,2,4-triazole.
| Compound Name | 1-(1-ethoxy-3-phenylocta-1,2-dienyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 10685430 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-(1-ethoxy-3-phenylocta-1,2-dienyl)-1,2,4-triazole |
| SMILES | CCCCCC(=C=C(OCC)n1cncn1)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O/c1-3-5-7-12-17(16-10-8-6-9-11-16)13-18(22-4-2)21-15-19-14-20-21/h6,8-11,14-15H,3-5,7,12H2,1-2H3 |
| InChIKey | LXZGEHHGHHVZGC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|