C26H24N4O — CID 10740793
N-[4-ethoxy-1,2-diphenyl-4-(1,2,4-triazol-1-yl)buta-2,3-dienyl]aniline (PubChem CID 10740793) has the molecular formula C26H24N4O and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[4-ethoxy-1,2-diphenyl-4-(1,2,4-triazol-1-yl)buta-2,3-dienyl]aniline.
| Compound Name | N-[4-ethoxy-1,2-diphenyl-4-(1,2,4-triazol-1-yl)buta-2,3-dienyl]aniline |
|---|---|
| PubChem CID | 10740793 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[4-ethoxy-1,2-diphenyl-4-(1,2,4-triazol-1-yl)buta-2,3-dienyl]aniline |
| SMILES | CCOC(=C=C(c1ccccc1)C(Nc1ccccc1)c1ccccc1)n1cncn1 |
| InChI | InChI=1S/C26H24N4O/c1-2-31-25(30-20-27-19-28-30)18-24(21-12-6-3-7-13-21)26(22-14-8-4-9-15-22)29-23-16-10-5-11-17-23/h3-17,19-20,26,29H,2H2,1H3 |
| InChIKey | ZFPQMXGQMVYNKZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|