C20H17NO — CID 36689702
(2S)-2-anilino-1,2-diphenylethanone (PubChem CID 36689702) has the molecular formula C20H17NO and a molecular weight of 287.36 g/mol. Its IUPAC name is (2S)-2-anilino-1,2-diphenylethanone.
| Compound Name | (2S)-2-anilino-1,2-diphenylethanone |
|---|---|
| PubChem CID | 36689702 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (2S)-2-anilino-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)[C@@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17NO/c22-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21-18-14-8-3-9-15-18/h1-15,19,21H/t19-/m0/s1 |
| InChIKey | SPWKVDHPFJFAAJ-IBGZPJMESA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |