C26H22NO2P — CID 86012008
2-(diphenylphosphorylamino)-1,2-diphenylethanone (PubChem CID 86012008) has the molecular formula C26H22NO2P and a molecular weight of 411.44 g/mol. Its IUPAC name is 2-(diphenylphosphorylamino)-1,2-diphenylethanone.
| Compound Name | 2-(diphenylphosphorylamino)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 86012008 |
| Molecular Formula | C26H22NO2P |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-(diphenylphosphorylamino)-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(NP(=O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H22NO2P/c28-26(22-15-7-2-8-16-22)25(21-13-5-1-6-14-21)27-30(29,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25H,(H,27,29) |
| InChIKey | YIONUSZKRYTWQP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|