C25H22NO4P — CID 135055281
(2R,3R)-3-(diphenylphosphorylamino)-3-(furan-2-yl)-2-hydroxy-1-phenylpropan-1-one (PubChem CID 135055281) has the molecular formula C25H22NO4P and a molecular weight of 431.43 g/mol. Its IUPAC name is (2R,3R)-3-(diphenylphosphorylamino)-3-(furan-2-yl)-2-hydroxy-1-phenylpropan-1-one.
| Compound Name | (2R,3R)-3-(diphenylphosphorylamino)-3-(furan-2-yl)-2-hydroxy-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 135055281 |
| Molecular Formula | C25H22NO4P |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (2R,3R)-3-(diphenylphosphorylamino)-3-(furan-2-yl)-2-hydroxy-1-phenylpropan-1-one |
| SMILES | O=C(c1ccccc1)[C@H](O)[C@@H](NP(=O)(c1ccccc1)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C25H22NO4P/c27-24(19-11-4-1-5-12-19)25(28)23(22-17-10-18-30-22)26-31(29,20-13-6-2-7-14-20)21-15-8-3-9-16-21/h1-18,23,25,28H,(H,26,29)/t23-,25+/m0/s1 |
| InChIKey | BECMJLFZRIOIQR-UKILVPOCSA-N |
| XLogP | 4.08 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|