C21H22NO2P — CID 132838677
N-diphenylphosphoryl-1-(furan-2-yl)-2-methylbut-3-en-1-amine (PubChem CID 132838677) has the molecular formula C21H22NO2P and a molecular weight of 351.39 g/mol. Its IUPAC name is N-diphenylphosphoryl-1-(furan-2-yl)-2-methylbut-3-en-1-amine.
| Compound Name | N-diphenylphosphoryl-1-(furan-2-yl)-2-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 132838677 |
| Molecular Formula | C21H22NO2P |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-diphenylphosphoryl-1-(furan-2-yl)-2-methylbut-3-en-1-amine |
| SMILES | C=CC(C)C(NP(=O)(c1ccccc1)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C21H22NO2P/c1-3-17(2)21(20-15-10-16-24-20)22-25(23,18-11-6-4-7-12-18)19-13-8-5-9-14-19/h3-17,21H,1H2,2H3,(H,22,23) |
| InChIKey | VUFRZFLVVPOFCT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|