C33H32NO2P — CID 11762891
(1R)-N-benzyl-2-diphenylphosphoryl-1-(furan-2-yl)-N-[(1R)-1-phenylethyl]ethanamine (PubChem CID 11762891) has the molecular formula C33H32NO2P and a molecular weight of 505.60 g/mol. Its IUPAC name is (1R)-N-benzyl-2-diphenylphosphoryl-1-(furan-2-yl)-N-[(1R)-1-phenylethyl]ethanamine.
| Compound Name | (1R)-N-benzyl-2-diphenylphosphoryl-1-(furan-2-yl)-N-[(1R)-1-phenylethyl]ethanamine |
|---|---|
| PubChem CID | 11762891 |
| Molecular Formula | C33H32NO2P |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | (1R)-N-benzyl-2-diphenylphosphoryl-1-(furan-2-yl)-N-[(1R)-1-phenylethyl]ethanamine |
| SMILES | C[C@H](c1ccccc1)N(Cc1ccccc1)[C@@H](CP(=O)(c1ccccc1)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C33H32NO2P/c1-27(29-17-8-3-9-18-29)34(25-28-15-6-2-7-16-28)32(33-23-14-24-36-33)26-37(35,30-19-10-4-11-20-30)31-21-12-5-13-22-31/h2-24,27,32H,25-26H2,1H3/t27-,32+/m1/s1 |
| InChIKey | MUHSDOLKWLTVPC-ZUKKLESISA-N |
| XLogP | 7.60 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|