C32H47NOSi2 — CID 101252588
(4S)-4-[benzyl-[(1R)-1-phenylethyl]amino]-4-phenyl-1-trimethylsilyl-2-(trimethylsilylmethyl)butan-2-ol (PubChem CID 101252588) has the molecular formula C32H47NOSi2 and a molecular weight of 517.91 g/mol. Its IUPAC name is (4S)-4-[benzyl-[(1R)-1-phenylethyl]amino]-4-phenyl-1-trimethylsilyl-2-(trimethylsilylmethyl)butan-2-ol.
| Compound Name | (4S)-4-[benzyl-[(1R)-1-phenylethyl]amino]-4-phenyl-1-trimethylsilyl-2-(trimethylsilylmethyl)butan-2-ol |
|---|---|
| PubChem CID | 101252588 |
| Molecular Formula | C32H47NOSi2 |
| Molecular Weight | 517.91 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | (4S)-4-[benzyl-[(1R)-1-phenylethyl]amino]-4-phenyl-1-trimethylsilyl-2-(trimethylsilylmethyl)butan-2-ol |
| SMILES | C[C@H](c1ccccc1)N(Cc1ccccc1)[C@@H](CC(O)(C[Si](C)(C)C)C[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C32H47NOSi2/c1-27(29-19-13-9-14-20-29)33(24-28-17-11-8-12-18-28)31(30-21-15-10-16-22-30)23-32(34,25-35(2,3)4)26-36(5,6)7/h8-22,27,31,34H,23-26H2,1-7H3/t27-,31+/m1/s1 |
| InChIKey | OFJLSDZGQFAUAP-JOMNFKBKSA-N |
| XLogP | 8.79 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.91 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|