C25H28NOP — CID 5461276
(E)-N-diphenylphosphoryl-2,2-dimethyl-1-phenylpent-3-en-1-amine (PubChem CID 5461276) has the molecular formula C25H28NOP and a molecular weight of 389.48 g/mol. Its IUPAC name is (E)-N-diphenylphosphoryl-2,2-dimethyl-1-phenylpent-3-en-1-amine.
| Compound Name | (E)-N-diphenylphosphoryl-2,2-dimethyl-1-phenylpent-3-en-1-amine |
|---|---|
| PubChem CID | 5461276 |
| Molecular Formula | C25H28NOP |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (E)-N-diphenylphosphoryl-2,2-dimethyl-1-phenylpent-3-en-1-amine |
| SMILES | C/C=C/C(C)(C)C(NP(=O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28NOP/c1-4-20-25(2,3)24(21-14-8-5-9-15-21)26-28(27,22-16-10-6-11-17-22)23-18-12-7-13-19-23/h4-20,24H,1-3H3,(H,26,27)/b20-4+ |
| InChIKey | OTTJNDQXIADKGM-LRNAUUFOSA-N |
| XLogP | 5.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|