C21H16Cl3F3NOP — CID 122369834
2,2,2-trichloro-N-diphenylphosphoryl-1-[4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 122369834) has the molecular formula C21H16Cl3F3NOP and a molecular weight of 492.69 g/mol. Its IUPAC name is 2,2,2-trichloro-N-diphenylphosphoryl-1-[4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2,2,2-trichloro-N-diphenylphosphoryl-1-[4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 122369834 |
| Molecular Formula | C21H16Cl3F3NOP |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | 2,2,2-trichloro-N-diphenylphosphoryl-1-[4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | O=P(NC(c1ccc(C(F)(F)F)cc1)C(Cl)(Cl)Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16Cl3F3NOP/c22-20(23,24)19(15-11-13-16(14-12-15)21(25,26)27)28-30(29,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,19H,(H,28,29) |
| InChIKey | KKQMYSKKHDHZKT-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|