C41H45N2O4PSi — CID 132916441
2-[dimethyl(phenyl)silyl]oxy-3-(diphenylphosphorylamino)-3-(4-methoxyphenyl)-2-phenyl-1-piperidin-1-ylpropan-1-one (PubChem CID 132916441) has the molecular formula C41H45N2O4PSi and a molecular weight of 688.88 g/mol. Its IUPAC name is 2-[dimethyl(phenyl)silyl]oxy-3-(diphenylphosphorylamino)-3-(4-methoxyphenyl)-2-phenyl-1-piperidin-1-ylpropan-1-one.
| Compound Name | 2-[dimethyl(phenyl)silyl]oxy-3-(diphenylphosphorylamino)-3-(4-methoxyphenyl)-2-phenyl-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 132916441 |
| Molecular Formula | C41H45N2O4PSi |
| Molecular Weight | 688.88 g/mol |
| Exact Mass | 688.29 |
| IUPAC Name | 2-[dimethyl(phenyl)silyl]oxy-3-(diphenylphosphorylamino)-3-(4-methoxyphenyl)-2-phenyl-1-piperidin-1-ylpropan-1-one |
| SMILES | COc1ccc(C(NP(=O)(c2ccccc2)c2ccccc2)C(O[Si](C)(C)c2ccccc2)(C(=O)N2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H45N2O4PSi/c1-46-35-29-27-33(28-30-35)39(42-48(45,36-21-11-5-12-22-36)37-23-13-6-14-24-37)41(34-19-9-4-10-20-34,40(44)43-31-17-8-18-32-43)47-49(2,3)38-25-15-7-16-26-38/h4-7,9-16,19-30,39H,8,17-18,31-32H2,1-3H3,(H,42,45) |
| InChIKey | ZPEAUHSGDYJQTB-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.88 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|