C42H59N2O5PSi — CID 139186757
(2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-tert-butylphenyl)-3-(diphenylphosphorylamino)-N,N-diethyl-3-(4-methoxyphenyl)propanamide;hydrate (PubChem CID 139186757) has the molecular formula C42H59N2O5PSi and a molecular weight of 731.00 g/mol. Its IUPAC name is (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-tert-butylphenyl)-3-(diphenylphosphorylamino)-N,N-diethyl-3-(4-methoxyphenyl)propanamide;hydrate.
| Compound Name | (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-tert-butylphenyl)-3-(diphenylphosphorylamino)-N,N-diethyl-3-(4-methoxyphenyl)propanamide;hydrate |
|---|---|
| PubChem CID | 139186757 |
| Molecular Formula | C42H59N2O5PSi |
| Molecular Weight | 731.00 g/mol |
| Exact Mass | 730.39 |
| IUPAC Name | (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-tert-butylphenyl)-3-(diphenylphosphorylamino)-N,N-diethyl-3-(4-methoxyphenyl)propanamide;hydrate |
| SMILES | CCN(CC)C(=O)[C@@](O[Si](C)(C)C(C)(C)C)(c1ccc(C(C)(C)C)cc1)[C@H](NP(=O)(c1ccccc1)c1ccccc1)c1ccc(OC)cc1.O |
| InChI | InChI=1S/C42H57N2O4PSi.H2O/c1-12-44(13-2)39(45)42(48-50(10,11)41(6,7)8,34-28-26-33(27-29-34)40(3,4)5)38(32-24-30-35(47-9)31-25-32)43-49(46,36-20-16-14-17-21-36)37-22-18-15-19-23-37;/h14-31,38H,12-13H2,1-11H3,(H,43,46);1H2/t38-,42-;/m1./s1 |
| InChIKey | ZTRAURCGSQIITQ-LGXBOEDGSA-N |
| XLogP | 8.51 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.00 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|