C23H19F2N2O2P — CID 134849768
4-[1-(diphenylphosphorylamino)-2,2-difluoro-3-oxobutyl]benzonitrile (PubChem CID 134849768) has the molecular formula C23H19F2N2O2P and a molecular weight of 424.39 g/mol. Its IUPAC name is 4-[1-(diphenylphosphorylamino)-2,2-difluoro-3-oxobutyl]benzonitrile.
| Compound Name | 4-[1-(diphenylphosphorylamino)-2,2-difluoro-3-oxobutyl]benzonitrile |
|---|---|
| PubChem CID | 134849768 |
| Molecular Formula | C23H19F2N2O2P |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4-[1-(diphenylphosphorylamino)-2,2-difluoro-3-oxobutyl]benzonitrile |
| SMILES | CC(=O)C(F)(F)C(NP(=O)(c1ccccc1)c1ccccc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H19F2N2O2P/c1-17(28)23(24,25)22(19-14-12-18(16-26)13-15-19)27-30(29,20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,22H,1H3,(H,27,29) |
| InChIKey | AGMABYJTZAKUAB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|