C27H22FN2OP — CID 138978103
(2S,3R)-3-(diphenylphosphorylamino)-2-fluoro-2,3-diphenylpropanenitrile (PubChem CID 138978103) has the molecular formula C27H22FN2OP and a molecular weight of 440.46 g/mol. Its IUPAC name is (2S,3R)-3-(diphenylphosphorylamino)-2-fluoro-2,3-diphenylpropanenitrile.
| Compound Name | (2S,3R)-3-(diphenylphosphorylamino)-2-fluoro-2,3-diphenylpropanenitrile |
|---|---|
| PubChem CID | 138978103 |
| Molecular Formula | C27H22FN2OP |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | (2S,3R)-3-(diphenylphosphorylamino)-2-fluoro-2,3-diphenylpropanenitrile |
| SMILES | N#C[C@](F)(c1ccccc1)[C@H](NP(=O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22FN2OP/c28-27(21-29,23-15-7-2-8-16-23)26(22-13-5-1-6-14-22)30-32(31,24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-20,26H,(H,30,31)/t26-,27+/m1/s1 |
| InChIKey | UAXRSAKPXFBWOH-SXOMAYOGSA-N |
| XLogP | 5.63 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|